Products 14254-17-2
CAS 14254-17-2 is the registry number for Cationic red GTL. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethyl-trimethylazanium;methyl sulfate (CAS 14254-17-2) is a chemical compound with the molecular formula C20H28ClN5O6S and a molecular weight of 502.0 g/mol. IUPAC name: 2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethyl-trimethylazanium;methyl sulfate. InChIKey: NUSZYOCSDMLOQE-UHFFFAOYSA-M.
| Molecular formula | C20H28ClN5O6S |
|---|---|
| Molecular weight | 502.0 g/mol |
| IUPAC name | 2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethyl-trimethylazanium;methyl sulfate |
| InChIKey | NUSZYOCSDMLOQE-UHFFFAOYSA-M |
| SMILES | CCN(CC[N+](C)(C)C)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2)[N+](=O)[O-])Cl.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)