CAS 14254-41-2 appears in our catalog under these names: Bis(2,4-dichlorophenyl) chlorophosphate, tech grade, 80%, Bis(2,4-dichlorophenyl) Phosphorochloridate, Bis(2,4-dichlorophenyl) Chlorophosphate (>80%), Bis(2,4-dichlorophenyl) chlorophosphate, Bis(2,4-dichlorophenyl) chlorophosphate, min. 95 %, 5 g. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, Roth. Available pack sizes: 5g, 1g, on request, 10g, 25g, 50g, 100g.
2,4-dichloro-1-[chloro-(2,4-dichlorophenoxy)phosphoryl]oxybenzene (CAS 14254-41-2) is a chemical compound with the molecular formula C12H6Cl5O3P and a molecular weight of 406.4 g/mol. IUPAC name: 2,4-dichloro-1-[chloro-(2,4-dichlorophenoxy)phosphoryl]oxybenzene. InChIKey: RHQSBXZVIMBYKW-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl5O3P |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | 2,4-dichloro-1-[chloro-(2,4-dichlorophenoxy)phosphoryl]oxybenzene |
| InChIKey | RHQSBXZVIMBYKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OP(=O)(OC2=C(C=C(C=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)