CAS 14257-74-0 appears in our catalog under these names: (2R,3S,4S,5R,6S)-2-(Aminomethyl)-6-methoxytetrahydro-2H-pyran-3,4,5-triol hydrochloride, 95%, Methyl 6-amino-6-deoxy-a-D-glucopyranoside HCl. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 500mg, 250mg, 1000mg.
(2R,3S,4S,5R,6S)-2-(aminomethyl)-6-methoxyoxane-3,4,5-triol;hydrochloride (CAS 14257-74-0) is a chemical compound with the molecular formula C7H16ClNO5 and a molecular weight of 229.66 g/mol. IUPAC name: (2R,3S,4S,5R,6S)-2-(aminomethyl)-6-methoxyoxane-3,4,5-triol;hydrochloride. InChIKey: GFQAHWOAVJXCGH-GQYLKJDFSA-N.
| Molecular formula | C7H16ClNO5 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | (2R,3S,4S,5R,6S)-2-(aminomethyl)-6-methoxyoxane-3,4,5-triol;hydrochloride |
| InChIKey | GFQAHWOAVJXCGH-GQYLKJDFSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CN)O)O)O.Cl |
Computed by PubChem (NCBI)