Products 1425931-78-7
CAS 1425931-78-7 is the registry number for 5-((1S,2R)-2-Fluorocyclopropyl)-1H-pyrazol-3-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrazol-3-amine (CAS 1425931-78-7) is a chemical compound with the molecular formula C6H8FN3 and a molecular weight of 141.15 g/mol. IUPAC name: 5-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrazol-3-amine. InChIKey: LMYIQELFORXUQE-QWWZWVQMSA-N.
| Molecular formula | C6H8FN3 |
|---|---|
| Molecular weight | 141.15 g/mol |
| IUPAC name | 5-[(1S,2R)-2-fluorocyclopropyl]-1H-pyrazol-3-amine |
| InChIKey | LMYIQELFORXUQE-QWWZWVQMSA-N |
| SMILES | C1[C@H]([C@@H]1F)C2=CC(=NN2)N |
Computed by PubChem (NCBI)