CAS 1425938-65-3 appears in our catalog under these names: Fmoc-(dmb)leu-oh, 95%, Fmoc–(Dmb)Leu–OH, Fmoc-L-DmbLeu-OH, Fmoc-(Dmb)Leu-OH, Fmoc-(Dmb)Leu-OH 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 5g, 250mg, 1g, 25g, 2000mg, 1000mg, 100mg.
(2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]-4-methylpentanoic acid (CAS 1425938-65-3) is a chemical compound with the molecular formula C30H33NO6 and a molecular weight of 503.6 g/mol. IUPAC name: (2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]-4-methylpentanoic acid. InChIKey: QPSOWMLPKHDMHL-MHZLTWQESA-N.
| Molecular formula | C30H33NO6 |
|---|---|
| Molecular weight | 503.6 g/mol |
| IUPAC name | (2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]-4-methylpentanoic acid |
| InChIKey | QPSOWMLPKHDMHL-MHZLTWQESA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)N(CC1=C(C=C(C=C1)OC)OC)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)