CAS 1425946-13-9 is the registry number for 9-((2,4-Dichlorophenyl)amino)thiazolo[5,4-f]quinazoline-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-(2,4-dichloroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carbonitrile (CAS 1425946-13-9) is a chemical compound with the molecular formula C16H7Cl2N5S and a molecular weight of 372.2 g/mol. IUPAC name: 9-(2,4-dichloroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carbonitrile. InChIKey: ZQVUSQHKVLBSEU-UHFFFAOYSA-N.
| Molecular formula | C16H7Cl2N5S |
|---|---|
| Molecular weight | 372.2 g/mol |
| IUPAC name | 9-(2,4-dichloroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carbonitrile |
| InChIKey | ZQVUSQHKVLBSEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)NC2=NC=NC3=C2C4=C(C=C3)N=C(S4)C#N |
Computed by PubChem (NCBI)