CAS 1426-58-0 is the registry number for Di(p-anisyl)iodonium Tetrafluoborate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
Bis(4-methoxyphenyl)iodanium tetrafluoroborate (CAS 1426-58-0) is a chemical compound with the molecular formula C14H14BF4IO2 and a molecular weight of 427.97 g/mol. IUPAC name: bis(4-methoxyphenyl)iodanium tetrafluoroborate. InChIKey: SUPXAGJMHPXDGH-UHFFFAOYSA-N.
| Molecular formula | C14H14BF4IO2 |
|---|---|
| Molecular weight | 427.97 g/mol |
| IUPAC name | bis(4-methoxyphenyl)iodanium tetrafluoroborate |
| InChIKey | SUPXAGJMHPXDGH-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.COC1=CC=C(C=C1)[I+]C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)