CAS 1426046-99-2 is the registry number for 2-(2,4-Difluorophenyl)-4-(trifluoromethyl)pyridine, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
2-(2,4-difluorophenyl)-4-(trifluoromethyl)pyridine (CAS 1426046-99-2) is a chemical compound with the molecular formula C12H6F5N and a molecular weight of 259.17 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-4-(trifluoromethyl)pyridine. InChIKey: AQGMGQHJNLJSEM-UHFFFAOYSA-N.
| Molecular formula | C12H6F5N |
|---|---|
| Molecular weight | 259.17 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-4-(trifluoromethyl)pyridine |
| InChIKey | AQGMGQHJNLJSEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=NC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)