CAS 1426089-85-1 is the registry number for 2-(tert-Butyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1426089-85-1) is a chemical compound with the molecular formula C13H22BNO2S and a molecular weight of 267.2 g/mol. IUPAC name: 2-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: USFAGWDMAPRQJL-UHFFFAOYSA-N.
| Molecular formula | C13H22BNO2S |
|---|---|
| Molecular weight | 267.2 g/mol |
| IUPAC name | 2-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | USFAGWDMAPRQJL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(S2)C(C)(C)C |
Computed by PubChem (NCBI)