CAS 1426129-51-2 is the registry number for (R)-3-([1,1'-Biphenyl]-4-yl)-2-(benzylamino)propan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(benzylamino)-3-(4-phenylphenyl)propan-1-ol (CAS 1426129-51-2) is a chemical compound with the molecular formula C22H23NO and a molecular weight of 317.4 g/mol. IUPAC name: (2R)-2-(benzylamino)-3-(4-phenylphenyl)propan-1-ol. InChIKey: BAPLXNYCJNONLN-JOCHJYFZSA-N.
| Molecular formula | C22H23NO |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | (2R)-2-(benzylamino)-3-(4-phenylphenyl)propan-1-ol |
| InChIKey | BAPLXNYCJNONLN-JOCHJYFZSA-N |
| SMILES | C1=CC=C(C=C1)CN[C@H](CC2=CC=C(C=C2)C3=CC=CC=C3)CO |
Computed by PubChem (NCBI)