CAS 1426213-63-9 appears in our catalog under these names: H-D-Lys(Z)-OtBu hydrochloride, 98%, D–Lys(Z)–OtBu·HCl, H-D-Lys(Cbz)-OtBu HCl 97%, tert-Butyl N6-((benzyloxy)carbonyl)-D-lysinate hydrochloride, 95%, 95%, (R)-tert-Butyl 2-amino-6-(((benzyloxy)carbonyl)amino)hexanoate hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 25g, 100g, 100mg, 10g.
Tert-butyl (2R)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride (CAS 1426213-63-9) is a chemical compound with the molecular formula C18H29ClN2O4 and a molecular weight of 372.9 g/mol. IUPAC name: tert-butyl (2R)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride. InChIKey: HEMZMPXAQORYDR-XFULWGLBSA-N.
| Molecular formula | C18H29ClN2O4 |
|---|---|
| Molecular weight | 372.9 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate;hydrochloride |
| InChIKey | HEMZMPXAQORYDR-XFULWGLBSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCCCNC(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)