Products 1426245-63-7
CAS 1426245-63-7 appears in our catalog under these names: 3–Methyl–4–morpholinophenylboronic Acid, (3-Methyl-4-morpholinophenyl)boronic acid 97%, (3-Methyl-4-morpholinophenyl)boronic acid, 98%, 98%, 3-METHYL-4-MORPHOLINOPHENYLBORONIC ACID, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3-methyl-4-morpholin-4-ylphenyl)boronic acid (CAS 1426245-63-7) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: (3-methyl-4-morpholin-4-ylphenyl)boronic acid. InChIKey: SPIHCTVLDYDVCE-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | (3-methyl-4-morpholin-4-ylphenyl)boronic acid |
| InChIKey | SPIHCTVLDYDVCE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N2CCOCC2)C)(O)O |
Computed by PubChem (NCBI)