CAS 1426296-49-2 is the registry number for Acynonapyr metabolite C. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg.
(1S,5R)-3-[2-propoxy-4-(trifluoromethyl)phenoxy]-9-azabicyclo[3.3.1]nonane (CAS 1426296-49-2) is a chemical compound with the molecular formula C18H24F3NO2 and a molecular weight of 343.4 g/mol. IUPAC name: (1S,5R)-3-[2-propoxy-4-(trifluoromethyl)phenoxy]-9-azabicyclo[3.3.1]nonane. InChIKey: FGLIIEIUQPTMAX-YIONKMFJSA-N.
| Molecular formula | C18H24F3NO2 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (1S,5R)-3-[2-propoxy-4-(trifluoromethyl)phenoxy]-9-azabicyclo[3.3.1]nonane |
| InChIKey | FGLIIEIUQPTMAX-YIONKMFJSA-N |
| SMILES | CCCOC1=C(C=CC(=C1)C(F)(F)F)OC2C[C@H]3CCC[C@@H](C2)N3 |
Computed by PubChem (NCBI)