Products 1426336-36-8
CAS 1426336-36-8 is the registry number for Nav1.7 blocker 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-(4-fluorophenoxy)phenyl]-6-[3-(hydroxymethyl)morpholin-4-yl]pyrimidine-4-carboxamide (CAS 1426336-36-8) is a chemical compound with the molecular formula C22H21FN4O4 and a molecular weight of 424.4 g/mol. IUPAC name: 2-[4-(4-fluorophenoxy)phenyl]-6-[3-(hydroxymethyl)morpholin-4-yl]pyrimidine-4-carboxamide. InChIKey: BLUJYESVOGVXSE-UHFFFAOYSA-N.
| Molecular formula | C22H21FN4O4 |
|---|---|
| Molecular weight | 424.4 g/mol |
| IUPAC name | 2-[4-(4-fluorophenoxy)phenyl]-6-[3-(hydroxymethyl)morpholin-4-yl]pyrimidine-4-carboxamide |
| InChIKey | BLUJYESVOGVXSE-UHFFFAOYSA-N |
| SMILES | C1COCC(N1C2=NC(=NC(=C2)C(=O)N)C3=CC=C(C=C3)OC4=CC=C(C=C4)F)CO |
Computed by PubChem (NCBI)