CAS 1426395-63-2 appears in our catalog under these names: (oxiran-2-yl-d3)methyl-d2 oleate, Oleic Acid 2,3-Epoxypropyl Ester-d5 (Glycidyl Oleate-d5), Glycidyl Oleate-D5, >95% (GC), Glycidyl oleate–d5, Glycidyl oleate-d5. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 10mg, 5mg, 2mg, 10 mg, 5 mg.
Oxiran-2-ylmethyl (Z)-2,2,3,3,4-pentadeuteriooctadec-9-enoate (CAS 1426395-63-2) is a chemical compound with the molecular formula C21H38O3 and a molecular weight of 343.6 g/mol. IUPAC name: oxiran-2-ylmethyl (Z)-2,2,3,3,4-pentadeuteriooctadec-9-enoate. InChIKey: VWYIWOYBERNXLX-LRHBODGVSA-N.
| Molecular formula | C21H38O3 |
|---|---|
| Molecular weight | 343.6 g/mol |
| IUPAC name | oxiran-2-ylmethyl (Z)-2,2,3,3,4-pentadeuteriooctadec-9-enoate |
| InChIKey | VWYIWOYBERNXLX-LRHBODGVSA-N |
| SMILES | [2H]C(CCCC/C=C\CCCCCCCC)C([2H])([2H])C([2H])([2H])C(=O)OCC1CO1 |
Computed by PubChem (NCBI)