CAS 1426421-76-2 appears in our catalog under these names: 5,6–Dichloro–3–iodo–1H–indazole, 5,6-Dichloro-3-iodo-1H-indazole, 5,6-Dichloro-3-iodo-1H-indazole 95%, 5,6-Dichloro-3-iodo-1H-indazole, 95%, 95%, 5,6-Dichloro-3-iodo-1H-indazole, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g.
5,6-dichloro-3-iodo-2H-indazole (CAS 1426421-76-2) is a chemical compound with the molecular formula C7H3Cl2IN2 and a molecular weight of 312.92 g/mol. IUPAC name: 5,6-dichloro-3-iodo-2H-indazole. InChIKey: SMVSNRUXCYESPW-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2IN2 |
|---|---|
| Molecular weight | 312.92 g/mol |
| IUPAC name | 5,6-dichloro-3-iodo-2H-indazole |
| InChIKey | SMVSNRUXCYESPW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=NNC(=C21)I)Cl)Cl |
Computed by PubChem (NCBI)