CAS 1426435-71-3 is the registry number for 4-Benzo[b]thien-2-yl-N-(4-benzo[b]thien-2-ylphenyl)benzenamine, 99%, 99%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
4-(1-benzothiophen-2-yl)-N-[4-(1-benzothiophen-2-yl)phenyl]aniline (CAS 1426435-71-3) is a chemical compound with the molecular formula C28H19NS2 and a molecular weight of 433.6 g/mol. IUPAC name: 4-(1-benzothiophen-2-yl)-N-[4-(1-benzothiophen-2-yl)phenyl]aniline. InChIKey: MKHQTERYZLGPGV-UHFFFAOYSA-N.
| Molecular formula | C28H19NS2 |
|---|---|
| Molecular weight | 433.6 g/mol |
| IUPAC name | 4-(1-benzothiophen-2-yl)-N-[4-(1-benzothiophen-2-yl)phenyl]aniline |
| InChIKey | MKHQTERYZLGPGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)C3=CC=C(C=C3)NC4=CC=C(C=C4)C5=CC6=CC=CC=C6S5 |
Computed by PubChem (NCBI)