CAS 142646-16-0 is the registry number for 6-(Phosphonomethyl)pyridine-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 100mg.
6-(phosphonomethyl)pyridine-2-carboxylic acid (CAS 142646-16-0) is a chemical compound with the molecular formula C7H8NO5P and a molecular weight of 217.12 g/mol. IUPAC name: 6-(phosphonomethyl)pyridine-2-carboxylic acid. InChIKey: HIDJRVUSOKZHOS-UHFFFAOYSA-N.
| Molecular formula | C7H8NO5P |
|---|---|
| Molecular weight | 217.12 g/mol |
| IUPAC name | 6-(phosphonomethyl)pyridine-2-carboxylic acid |
| InChIKey | HIDJRVUSOKZHOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)O)CP(=O)(O)O |
Computed by PubChem (NCBI)