CAS 142646-43-3 appears in our catalog under these names: 8–(1,1–Dimethyl–2–propenyl)kaempferol, 8-(1,1-Dimethyl-2-propenyl)kaempferol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
3,5,7-trihydroxy-2-(4-hydroxyphenyl)-8-(2-methylbut-3-en-2-yl)chromen-4-one (CAS 142646-43-3) is a chemical compound with the molecular formula C20H18O6 and a molecular weight of 354.4 g/mol. IUPAC name: 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-8-(2-methylbut-3-en-2-yl)chromen-4-one. InChIKey: GHPQDENIZBUDAA-UHFFFAOYSA-N.
| Molecular formula | C20H18O6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-8-(2-methylbut-3-en-2-yl)chromen-4-one |
| InChIKey | GHPQDENIZBUDAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C=C)C1=C(C=C(C2=C1OC(=C(C2=O)O)C3=CC=C(C=C3)O)O)O |
Computed by PubChem (NCBI)