CAS 14267-17-5 appears in our catalog under these names: Nickel diethyldithiocarbamate, 97%, Nickel Diethyldithiocarbamate, Nickel Diethyldithiocarbamate, >97.0%(T). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 5g, 100g, 25g, 1g, 500g.
Bis(N,N-diethylcarbamodithioate);nickel(2+) (CAS 14267-17-5) is a chemical compound with the molecular formula C10H20N2NiS4 and a molecular weight of 355.2 g/mol. IUPAC name: bis(N,N-diethylcarbamodithioate);nickel(2+). InChIKey: NCLUCMXMAPDFGT-UHFFFAOYSA-L.
| Molecular formula | C10H20N2NiS4 |
|---|---|
| Molecular weight | 355.2 g/mol |
| IUPAC name | bis(N,N-diethylcarbamodithioate);nickel(2+) |
| InChIKey | NCLUCMXMAPDFGT-UHFFFAOYSA-L |
| SMILES | CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Ni+2] |
Computed by PubChem (NCBI)