Products 1426824-36-3
CAS 1426824-36-3 is the registry number for BPH-1218. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-(3-decylimidazol-1-ium-1-yl)-1-phosphonoethyl]-hydroxyphosphinate (CAS 1426824-36-3) is a chemical compound with the molecular formula C15H30N2O6P2 and a molecular weight of 396.36 g/mol. IUPAC name: [2-(3-decylimidazol-1-ium-1-yl)-1-phosphonoethyl]-hydroxyphosphinate. InChIKey: GYTSEUQBLYSXFG-UHFFFAOYSA-N.
| Molecular formula | C15H30N2O6P2 |
|---|---|
| Molecular weight | 396.36 g/mol |
| IUPAC name | [2-(3-decylimidazol-1-ium-1-yl)-1-phosphonoethyl]-hydroxyphosphinate |
| InChIKey | GYTSEUQBLYSXFG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCN1C=C[N+](=C1)CC(P(=O)(O)O)P(=O)(O)[O-] |
Computed by PubChem (NCBI)