CAS 1426833-00-2 is the registry number for MTFSILi. Offered by: TRC. Available pack sizes: 100mg.
Lithium 3-(2-methylprop-2-enoyloxy)propylsulfonyl-(trifluoromethylsulfonyl)azanide (CAS 1426833-00-2) is a chemical compound with the molecular formula C8H11F3LiNO6S2 and a molecular weight of 345.3 g/mol. IUPAC name: lithium 3-(2-methylprop-2-enoyloxy)propylsulfonyl-(trifluoromethylsulfonyl)azanide. InChIKey: ITDHBCAWFMJEET-UHFFFAOYSA-N.
| Molecular formula | C8H11F3LiNO6S2 |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | lithium 3-(2-methylprop-2-enoyloxy)propylsulfonyl-(trifluoromethylsulfonyl)azanide |
| InChIKey | ITDHBCAWFMJEET-UHFFFAOYSA-N |
| SMILES | [Li+].CC(=C)C(=O)OCCCS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)