Products 1426833-08-0
CAS 1426833-08-0 is the registry number for PDE2/PDE10-IN-1, 99.88%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 50 mg, 25 mg, 100 mg, 10 mg, 10mM/1mL.
3-(2-chlorophenyl)-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (CAS 1426833-08-0) is a chemical compound with the molecular formula C15H10ClN5 and a molecular weight of 295.72 g/mol. IUPAC name: 3-(2-chlorophenyl)-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene. InChIKey: SNQXTEAQGLZIDL-UHFFFAOYSA-N.
| Molecular formula | C15H10ClN5 |
|---|---|
| Molecular weight | 295.72 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| InChIKey | SNQXTEAQGLZIDL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=NC=C2)N3C1=NN=C3C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)