CAS 14270-73-6 appears in our catalog under these names: 5'–O–Trityl–2'–deoxyuridine, 2'-Deoxy-5'-O-trityluridine, 5’-O-Triphenylmethyl-2’-deoxyuridine 95%, 5'-O-Trityl-2'-deoxyuridine, 95%, 95%, 5’-O-Triphenylmethyl-2’-deoxyuridine. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 2g, 10g, 250mg, 250 mg, 1 g, 5 g.
1-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 14270-73-6) is a chemical compound with the molecular formula C28H26N2O5 and a molecular weight of 470.5 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: JJJNFNLUKYZAKI-BFLUCZKCSA-N.
| Molecular formula | C28H26N2O5 |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | JJJNFNLUKYZAKI-BFLUCZKCSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)O |
Computed by PubChem (NCBI)