CAS 1427002-41-2 is the registry number for 2,3,6,7,10,11-Hexa(pyridin-3-yl)triphenylene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,6,7,10,11-pentapyridin-3-yltriphenylen-2-yl)pyridine (CAS 1427002-41-2) is a chemical compound with the molecular formula C48H30N6 and a molecular weight of 690.8 g/mol. IUPAC name: 3-(3,6,7,10,11-pentapyridin-3-yltriphenylen-2-yl)pyridine. InChIKey: UBHPERCXCJQQGJ-UHFFFAOYSA-N.
| Molecular formula | C48H30N6 |
|---|---|
| Molecular weight | 690.8 g/mol |
| IUPAC name | 3-(3,6,7,10,11-pentapyridin-3-yltriphenylen-2-yl)pyridine |
| InChIKey | UBHPERCXCJQQGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=C(C=C3C(=C2)C4=CC(=C(C=C4C5=CC(=C(C=C35)C6=CN=CC=C6)C7=CN=CC=C7)C8=CN=CC=C8)C9=CN=CC=C9)C1=CN=CC=C1 |
Computed by PubChem (NCBI)