Products 1427012-35-8

CAS 1427012-35-8 is the registry number for 1-(1,3,4-Oxadiazol-2-yl)cyclopropanecarboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-(1,3,4-oxadiazol-2-yl)cyclopropane-1-carboxylic acid (CAS 1427012-35-8) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 1-(1,3,4-oxadiazol-2-yl)cyclopropane-1-carboxylic acid. InChIKey: RTGBACOILGBKPT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N2O3
Molecular weight154.12 g/mol
IUPAC name1-(1,3,4-oxadiazol-2-yl)cyclopropane-1-carboxylic acid
InChIKeyRTGBACOILGBKPT-UHFFFAOYSA-N
SMILESC1CC1(C2=NN=CO2)C(=O)O

Computed by PubChem (NCBI)