CAS 1427028-33-8 is the registry number for 2-((2-Chloro-4-fluorobenzyl)oxy)-3,4-dimethylbenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-chloro-4-fluorophenyl)methoxy]-3,4-dimethylbenzaldehyde (CAS 1427028-33-8) is a chemical compound with the molecular formula C16H14ClFO2 and a molecular weight of 292.73 g/mol. IUPAC name: 2-[(2-chloro-4-fluorophenyl)methoxy]-3,4-dimethylbenzaldehyde. InChIKey: NXIWMEYCLYLSOD-UHFFFAOYSA-N.
| Molecular formula | C16H14ClFO2 |
|---|---|
| Molecular weight | 292.73 g/mol |
| IUPAC name | 2-[(2-chloro-4-fluorophenyl)methoxy]-3,4-dimethylbenzaldehyde |
| InChIKey | NXIWMEYCLYLSOD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C=O)OCC2=C(C=C(C=C2)F)Cl)C |
Computed by PubChem (NCBI)