CAS 1427054-10-1 appears in our catalog under these names: 1,5-Bis(2-bromo-5-hydroxyphenyl)pentan-3-one, 95%, 1,5-Bis(2-bromo-5-hydroxyphenyl)pentan-3-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 5000mg, 10000mg.
1,5-bis(2-bromo-5-hydroxyphenyl)pentan-3-one (CAS 1427054-10-1) is a chemical compound with the molecular formula C17H16Br2O3 and a molecular weight of 428.1 g/mol. IUPAC name: 1,5-bis(2-bromo-5-hydroxyphenyl)pentan-3-one. InChIKey: NAHHPYGGBUSAIU-UHFFFAOYSA-N.
| Molecular formula | C17H16Br2O3 |
|---|---|
| Molecular weight | 428.1 g/mol |
| IUPAC name | 1,5-bis(2-bromo-5-hydroxyphenyl)pentan-3-one |
| InChIKey | NAHHPYGGBUSAIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)CCC(=O)CCC2=C(C=CC(=C2)O)Br)Br |
Computed by PubChem (NCBI)