CAS 1427190-91-7 is the registry number for Potassium (2-(1,3-dioxolan-2-yl)ethyl)trifluoroborate, 95+%, 95+%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Potassium 2-(1,3-dioxolan-2-yl)ethyl-trifluoroboranuide (CAS 1427190-91-7) is a chemical compound with the molecular formula C5H9BF3KO2 and a molecular weight of 208.03 g/mol. IUPAC name: potassium 2-(1,3-dioxolan-2-yl)ethyl-trifluoroboranuide. InChIKey: HUPMIFQWTUXUPL-UHFFFAOYSA-N.
| Molecular formula | C5H9BF3KO2 |
|---|---|
| Molecular weight | 208.03 g/mol |
| IUPAC name | potassium 2-(1,3-dioxolan-2-yl)ethyl-trifluoroboranuide |
| InChIKey | HUPMIFQWTUXUPL-UHFFFAOYSA-N |
| SMILES | [B-](CCC1OCCO1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)