Products 1427324-31-9
CAS 1427324-31-9 appears in our catalog under these names: 8-Bromo-5-chloroimidazo(1,5-a)pyridine, 8-bromo-5-chloroimidazo[1,5-a]pyridine, >97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
8-bromo-5-chloroimidazo[1,5-a]pyridine (CAS 1427324-31-9) is a chemical compound with the molecular formula C7H4BrClN2 and a molecular weight of 231.48 g/mol. IUPAC name: 8-bromo-5-chloroimidazo[1,5-a]pyridine. InChIKey: LOLLNLWWRVQKEN-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2 |
|---|---|
| Molecular weight | 231.48 g/mol |
| IUPAC name | 8-bromo-5-chloroimidazo[1,5-a]pyridine |
| InChIKey | LOLLNLWWRVQKEN-UHFFFAOYSA-N |
| SMILES | C1=C(C2=CN=CN2C(=C1)Cl)Br |
Computed by PubChem (NCBI)