Products 1427360-42-6
CAS 1427360-42-6 is the registry number for 6-Chloroimidazo[1,2-a]pyridine-8-carbonitrile, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-chloroimidazo[1,2-a]pyridine-8-carbonitrile (CAS 1427360-42-6) is a chemical compound with the molecular formula C8H4ClN3 and a molecular weight of 177.59 g/mol. IUPAC name: 6-chloroimidazo[1,2-a]pyridine-8-carbonitrile. InChIKey: MJOTYLWDFFLMNG-UHFFFAOYSA-N.
| Molecular formula | C8H4ClN3 |
|---|---|
| Molecular weight | 177.59 g/mol |
| IUPAC name | 6-chloroimidazo[1,2-a]pyridine-8-carbonitrile |
| InChIKey | MJOTYLWDFFLMNG-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)C#N)Cl |
Computed by PubChem (NCBI)