CAS 1427375-26-5 is the registry number for 5-Bromo-7-chloropyrazolo[1,5-a]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-7-chloropyrazolo[1,5-a]pyridine (CAS 1427375-26-5) is a chemical compound with the molecular formula C7H4BrClN2 and a molecular weight of 231.48 g/mol. IUPAC name: 5-bromo-7-chloropyrazolo[1,5-a]pyridine. InChIKey: NYEBLPXQZSUILV-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2 |
|---|---|
| Molecular weight | 231.48 g/mol |
| IUPAC name | 5-bromo-7-chloropyrazolo[1,5-a]pyridine |
| InChIKey | NYEBLPXQZSUILV-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C=C(N2N=C1)Cl)Br |
Computed by PubChem (NCBI)