CAS 1427377-41-0 is the registry number for 6-Bromo-4-fluoro-2-methyl-1H-indole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-bromo-4-fluoro-2-methyl-1H-indole (CAS 1427377-41-0) is a chemical compound with the molecular formula C9H7BrFN and a molecular weight of 228.06 g/mol. IUPAC name: 6-bromo-4-fluoro-2-methyl-1H-indole. InChIKey: UEHNFZXIFKIMEY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFN |
|---|---|
| Molecular weight | 228.06 g/mol |
| IUPAC name | 6-bromo-4-fluoro-2-methyl-1H-indole |
| InChIKey | UEHNFZXIFKIMEY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=C(C=C2F)Br |
Computed by PubChem (NCBI)