CAS 1427380-03-7 is the registry number for Sodium 2-(1,3-thiazol-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
Sodium 2-(1,3-thiazol-2-yl)acetate (CAS 1427380-03-7) is a chemical compound with the molecular formula C5H4NNaO2S and a molecular weight of 165.15 g/mol. IUPAC name: sodium 2-(1,3-thiazol-2-yl)acetate. InChIKey: OCSCGZPMIKVUMF-UHFFFAOYSA-M.
| Molecular formula | C5H4NNaO2S |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | sodium 2-(1,3-thiazol-2-yl)acetate |
| InChIKey | OCSCGZPMIKVUMF-UHFFFAOYSA-M |
| SMILES | C1=CSC(=N1)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)