CAS 1427381-00-7 appears in our catalog under these names: 3-{((dimethyl-1,2-oxazol-4-yl)methyl)(methyl)amino}propanoic acid hydrochloride, 95%, 3-{((Dimethyl-1,2-oxazol-4-yl)methyl)(methyl)amino}propanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride (CAS 1427381-00-7) is a chemical compound with the molecular formula C10H17ClN2O3 and a molecular weight of 248.70 g/mol. IUPAC name: 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride. InChIKey: XBQSRUBQUHJMID-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O3 |
|---|---|
| Molecular weight | 248.70 g/mol |
| IUPAC name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride |
| InChIKey | XBQSRUBQUHJMID-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CN(C)CCC(=O)O.Cl |
Computed by PubChem (NCBI)