CAS 1427394-72-6 is the registry number for 6-Bromo-7-methylisoindolin-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
6-bromo-7-methyl-2,3-dihydroisoindol-1-one (CAS 1427394-72-6) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 6-bromo-7-methyl-2,3-dihydroisoindol-1-one. InChIKey: VKWDKEYQJBHVQU-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 6-bromo-7-methyl-2,3-dihydroisoindol-1-one |
| InChIKey | VKWDKEYQJBHVQU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=O)NC2)Br |
Computed by PubChem (NCBI)