CAS 1427396-65-3 appears in our catalog under these names: 3-Trifluoromethoxybenzylhydrazine dihydrochloride, 95%, (3-(Trifluoromethoxy)benzyl)hydrazine dihydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 25g.
[3-(trifluoromethoxy)phenyl]methylhydrazine;dihydrochloride (CAS 1427396-65-3) is a chemical compound with the molecular formula C8H11Cl2F3N2O and a molecular weight of 279.08 g/mol. IUPAC name: [3-(trifluoromethoxy)phenyl]methylhydrazine;dihydrochloride. InChIKey: IDWPMZVRJVJYMJ-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2F3N2O |
|---|---|
| Molecular weight | 279.08 g/mol |
| IUPAC name | [3-(trifluoromethoxy)phenyl]methylhydrazine;dihydrochloride |
| InChIKey | IDWPMZVRJVJYMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)CNN.Cl.Cl |
Computed by PubChem (NCBI)