Products 1427432-71-0

CAS 1427432-71-0 is the registry number for Methyl 3-(hydroxymethyl)-4-methylbenzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 3-(hydroxymethyl)-4-methylbenzoate (CAS 1427432-71-0) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: methyl 3-(hydroxymethyl)-4-methylbenzoate. InChIKey: QSMKKOCKOHLUSC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O3
Molecular weight180.20 g/mol
IUPAC namemethyl 3-(hydroxymethyl)-4-methylbenzoate
InChIKeyQSMKKOCKOHLUSC-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(=O)OC)CO

Computed by PubChem (NCBI)