CAS 142745-26-4 is the registry number for R–2–ISOPROPYL–1–(TOLUENE–4–SULFONYL)–AZIRIDINE. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
(2R)-1-(4-methylphenyl)sulfonyl-2-propan-2-ylaziridine (CAS 142745-26-4) is a chemical compound with the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. IUPAC name: (2R)-1-(4-methylphenyl)sulfonyl-2-propan-2-ylaziridine. InChIKey: KEQXAGSLQICYGJ-UEWDXFNNSA-N.
| Molecular formula | C12H17NO2S |
|---|---|
| Molecular weight | 239.34 g/mol |
| IUPAC name | (2R)-1-(4-methylphenyl)sulfonyl-2-propan-2-ylaziridine |
| InChIKey | KEQXAGSLQICYGJ-UEWDXFNNSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C[C@H]2C(C)C |
Computed by PubChem (NCBI)