Products 1427468-69-6
CAS 1427468-69-6 is the registry number for N-tert-Butyl-5-chlorobenzo(d)oxazol-2-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
N-tert-butyl-5-chloro-1,3-benzoxazol-2-amine (CAS 1427468-69-6) is a chemical compound with the molecular formula C11H13ClN2O and a molecular weight of 224.68 g/mol. IUPAC name: N-tert-butyl-5-chloro-1,3-benzoxazol-2-amine. InChIKey: OHVHYPASLWQTLD-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | N-tert-butyl-5-chloro-1,3-benzoxazol-2-amine |
| InChIKey | OHVHYPASLWQTLD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=NC2=C(O1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)