CAS 1427556-53-3 is the registry number for N-Phenyl-3-dibenzothiophenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
N-phenyldibenzothiophen-3-amine (CAS 1427556-53-3) is a chemical compound with the molecular formula C18H13NS and a molecular weight of 275.4 g/mol. IUPAC name: N-phenyldibenzothiophen-3-amine. InChIKey: DUGUHFXDUFGEAQ-UHFFFAOYSA-N.
| Molecular formula | C18H13NS |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | N-phenyldibenzothiophen-3-amine |
| InChIKey | DUGUHFXDUFGEAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC3=C(C=C2)C4=CC=CC=C4S3 |
Computed by PubChem (NCBI)