CAS 1427587-60-7 is the registry number for (R)-2-Methyl-N-(oxetan-3-ylidene)propane-2-sulfinamide, 95+%. Offered by: AmBeed. Available pack sizes: 10g.
(R)-2-methyl-N-(oxetan-3-ylidene)propane-2-sulfinamide (CAS 1427587-60-7) is a chemical compound with the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. IUPAC name: (R)-2-methyl-N-(oxetan-3-ylidene)propane-2-sulfinamide. InChIKey: VKUZMNXQGKBLHN-LLVKDONJSA-N.
| Molecular formula | C7H13NO2S |
|---|---|
| Molecular weight | 175.25 g/mol |
| IUPAC name | (R)-2-methyl-N-(oxetan-3-ylidene)propane-2-sulfinamide |
| InChIKey | VKUZMNXQGKBLHN-LLVKDONJSA-N |
| SMILES | CC(C)(C)[S@@](=O)N=C1COC1 |
Computed by PubChem (NCBI)