CAS 14276-99-4 appears in our catalog under these names: sodium phenyl sulfate, 95%, Phenylsulfate Sodium Salt, Sodium phenyl sulfate, 95.0%. Offered by: Combi-blocks, Chemat Brand, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg, on request.
Sodium phenyl sulfate (CAS 14276-99-4) is a chemical compound with the molecular formula C6H5NaO4S and a molecular weight of 196.16 g/mol. IUPAC name: sodium phenyl sulfate. InChIKey: PNFSYNAUAPBVGF-UHFFFAOYSA-M.
| Molecular formula | C6H5NaO4S |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | sodium phenyl sulfate |
| InChIKey | PNFSYNAUAPBVGF-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)