CAS 142763-10-8 appears in our catalog under these names: (R)-2-chloro-1-(3-chlorophenyl)ethanol, (R)-2-chloro-1-(3-chlorophenyl)ethan-1-ol, 95%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 1g, 25mg.
(1R)-2-chloro-1-(3-chlorophenyl)ethanol (CAS 142763-10-8) is a chemical compound with the molecular formula C8H8Cl2O and a molecular weight of 191.05 g/mol. IUPAC name: (1R)-2-chloro-1-(3-chlorophenyl)ethanol. InChIKey: LBSKQOSGSUKVDG-QMMMGPOBSA-N.
| Molecular formula | C8H8Cl2O |
|---|---|
| Molecular weight | 191.05 g/mol |
| IUPAC name | (1R)-2-chloro-1-(3-chlorophenyl)ethanol |
| InChIKey | LBSKQOSGSUKVDG-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CCl)O |
Computed by PubChem (NCBI)