CAS 14279-64-2 appears in our catalog under these names: Tos-arg-nh2 hydrochloride, 95%, Tos-L-Arg-NH2*HCl. Offered by: Combi-blocks, Creative Peptides. Available pack sizes: 5g, 100g, 10g, 1g, 25g.
(2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanamide;hydrochloride (CAS 14279-64-2) is a chemical compound with the molecular formula C13H22ClN5O3S and a molecular weight of 363.86 g/mol. IUPAC name: (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanamide;hydrochloride. InChIKey: ULGNEWYDCYUHJH-MERQFXBCSA-N.
| Molecular formula | C13H22ClN5O3S |
|---|---|
| Molecular weight | 363.86 g/mol |
| IUPAC name | (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanamide;hydrochloride |
| InChIKey | ULGNEWYDCYUHJH-MERQFXBCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)N.Cl |
Computed by PubChem (NCBI)