CAS 142798-54-7 is the registry number for rac-((1R,2S)-2-((tert-Butyldimethylsilyl)oxy)cyclohexyl)methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]methanol (CAS 142798-54-7) is a chemical compound with the molecular formula C13H28O2Si and a molecular weight of 244.44 g/mol. IUPAC name: [(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]methanol. InChIKey: RRLGSESJSQXNHX-NWDGAFQWSA-N.
| Molecular formula | C13H28O2Si |
|---|---|
| Molecular weight | 244.44 g/mol |
| IUPAC name | [(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]methanol |
| InChIKey | RRLGSESJSQXNHX-NWDGAFQWSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCC[C@H]1CO |
Computed by PubChem (NCBI)