CAS 1428035-73-7 is the registry number for 6-Chloro-N4-(2,2-difluoroethyl)pyrimidine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-N-(2,2-difluoroethyl)pyrimidine-2,4-diamine (CAS 1428035-73-7) is a chemical compound with the molecular formula C6H7ClF2N4 and a molecular weight of 208.60 g/mol. IUPAC name: 6-chloro-4-N-(2,2-difluoroethyl)pyrimidine-2,4-diamine. InChIKey: WCMTYAFEAKEJJB-UHFFFAOYSA-N.
| Molecular formula | C6H7ClF2N4 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 6-chloro-4-N-(2,2-difluoroethyl)pyrimidine-2,4-diamine |
| InChIKey | WCMTYAFEAKEJJB-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N=C1Cl)N)NCC(F)F |
Computed by PubChem (NCBI)