CAS 1428139-55-2 appears in our catalog under these names: 2,4-Dichloro-5-(2-thienyl)thieno[2,3-d]pyrimidine, 95%, 2,4-DIchloro-5-(2-thienyl)thieno(2,3-d)pyrimidine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2,4-dichloro-5-thiophen-2-ylthieno[2,3-d]pyrimidine (CAS 1428139-55-2) is a chemical compound with the molecular formula C10H4Cl2N2S2 and a molecular weight of 287.2 g/mol. IUPAC name: 2,4-dichloro-5-thiophen-2-ylthieno[2,3-d]pyrimidine. InChIKey: CULKNUZFOKJBKR-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2N2S2 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 2,4-dichloro-5-thiophen-2-ylthieno[2,3-d]pyrimidine |
| InChIKey | CULKNUZFOKJBKR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CSC3=C2C(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)