CAS 1428141-39-2 is the registry number for 2,4-Dichloro-5-(2-furyl)thieno[2,3-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,4-dichloro-5-(furan-2-yl)thieno[2,3-d]pyrimidine (CAS 1428141-39-2) is a chemical compound with the molecular formula C10H4Cl2N2OS and a molecular weight of 271.12 g/mol. IUPAC name: 2,4-dichloro-5-(furan-2-yl)thieno[2,3-d]pyrimidine. InChIKey: MGWZMVNZNAIHQC-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2N2OS |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 2,4-dichloro-5-(furan-2-yl)thieno[2,3-d]pyrimidine |
| InChIKey | MGWZMVNZNAIHQC-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CSC3=C2C(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)