Products 1428234-48-3

CAS 1428234-48-3 appears in our catalog under these names: 2,6-Difluoro-4-(methylthio)benzyl alcohol, 95%, 2,6-Difluoro-4-(methylthio)benzyl alcohol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2,6-difluoro-4-methylsulfanylphenyl)methanol (CAS 1428234-48-3) is a chemical compound with the molecular formula C8H8F2OS and a molecular weight of 190.21 g/mol. IUPAC name: (2,6-difluoro-4-methylsulfanylphenyl)methanol. InChIKey: IVXNURDCSQCVAF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8F2OS
Molecular weight190.21 g/mol
IUPAC name(2,6-difluoro-4-methylsulfanylphenyl)methanol
InChIKeyIVXNURDCSQCVAF-UHFFFAOYSA-N
SMILESCSC1=CC(=C(C(=C1)F)CO)F

Computed by PubChem (NCBI)